C12H12F3N3O — CID 107686258
[4-[[1-(difluoromethyl)imidazol-2-yl]methoxy]-3-fluorophenyl]methanamine (PubChem CID 107686258) has the molecular formula C12H12F3N3O and a molecular weight of 271.24 g/mol. Its IUPAC name is [4-[[1-(difluoromethyl)imidazol-2-yl]methoxy]-3-fluorophenyl]methanamine.
| Compound Name | [4-[[1-(difluoromethyl)imidazol-2-yl]methoxy]-3-fluorophenyl]methanamine |
|---|---|
| PubChem CID | 107686258 |
| Molecular Formula | C12H12F3N3O |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | [4-[[1-(difluoromethyl)imidazol-2-yl]methoxy]-3-fluorophenyl]methanamine |
| SMILES | NCc1ccc(OCc2nccn2C(F)F)c(F)c1 |
| InChI | InChI=1S/C12H12F3N3O/c13-9-5-8(6-16)1-2-10(9)19-7-11-17-3-4-18(11)12(14)15/h1-5,12H,6-7,16H2 |
| InChIKey | UFHQHNYUVNUEJO-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |