C25H28F3N3O5S — CID 10768770
benzyl (4aR,7S)-1-amino-3-methyl-7-(2-phenylethyl)-4a,5,6,7-tetrahydro-2H-pyrrolo[1,2-c]pyrimidin-8-ium-4-carboxylate;trifluoromethanesulfonate (PubChem CID 10768770) has the molecular formula C25H28F3N3O5S and a molecular weight of 539.58 g/mol. Its IUPAC name is benzyl (4aR,7S)-1-amino-3-methyl-7-(2-phenylethyl)-4a,5,6,7-tetrahydro-2H-pyrrolo[1,2-c]pyrimidin-8-ium-4-carboxylate;trifluoromethanesulfonate.
| Compound Name | benzyl (4aR,7S)-1-amino-3-methyl-7-(2-phenylethyl)-4a,5,6,7-tetrahydro-2H-pyrrolo[1,2-c]pyrimidin-8-ium-4-carboxylate;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10768770 |
| Molecular Formula | C25H28F3N3O5S |
| Molecular Weight | 539.58 g/mol |
| Exact Mass | 539.17 |
| IUPAC Name | benzyl (4aR,7S)-1-amino-3-methyl-7-(2-phenylethyl)-4a,5,6,7-tetrahydro-2H-pyrrolo[1,2-c]pyrimidin-8-ium-4-carboxylate;trifluoromethanesulfonate |
| SMILES | CC1=C(C(=O)OCc2ccccc2)[C@H]2CC[C@H](CCc3ccccc3)[N+]2=C(N)N1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C24H27N3O2.CHF3O3S/c1-17-22(23(28)29-16-19-10-6-3-7-11-19)21-15-14-20(27(21)24(25)26-17)13-12-18-8-4-2-5-9-18;2-1(3,4)8(5,6)7/h2-11,20-21H,12-16H2,1H3,(H2,25,26,28);(H,5,6,7)/t20-,21+;/m0./s1 |
| InChIKey | RYZKBPIDSDSKOV-JUDYQFGCSA-N |
| XLogP | 3.15 |
| TPSA | 124.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.58 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|