C32H51N4O5+ — CID 3012874
4-(phenylmethoxycarbonylamino)butyl (4aS,7S)-1-amino-7-[(2S)-2-hydroxyundecyl]-3-methyl-4a,5,6,7-tetrahydro-2H-pyrrolo[1,2-c]pyrimidin-8-ium-4-carboxylate (PubChem CID 3012874) has the molecular formula C32H51N4O5+ and a molecular weight of 571.78 g/mol. Its IUPAC name is 4-(phenylmethoxycarbonylamino)butyl (4aS,7S)-1-amino-7-[(2S)-2-hydroxyundecyl]-3-methyl-4a,5,6,7-tetrahydro-2H-pyrrolo[1,2-c]pyrimidin-8-ium-4-carboxylate.
| Compound Name | 4-(phenylmethoxycarbonylamino)butyl (4aS,7S)-1-amino-7-[(2S)-2-hydroxyundecyl]-3-methyl-4a,5,6,7-tetrahydro-2H-pyrrolo[1,2-c]pyrimidin-8-ium-4-carboxylate |
|---|---|
| PubChem CID | 3012874 |
| Molecular Formula | C32H51N4O5+ |
| Molecular Weight | 571.78 g/mol |
| Exact Mass | 571.39 |
| IUPAC Name | 4-(phenylmethoxycarbonylamino)butyl (4aS,7S)-1-amino-7-[(2S)-2-hydroxyundecyl]-3-methyl-4a,5,6,7-tetrahydro-2H-pyrrolo[1,2-c]pyrimidin-8-ium-4-carboxylate |
| SMILES | CCCCCCCCC[C@H](O)C[C@@H]1CC[C@H]2C(C(=O)OCCCCNC(=O)OCc3ccccc3)=C(C)NC(N)=[N+]12 |
| InChI | InChI=1S/C32H50N4O5/c1-3-4-5-6-7-8-12-17-27(37)22-26-18-19-28-29(24(2)35-31(33)36(26)28)30(38)40-21-14-13-20-34-32(39)41-23-25-15-10-9-11-16-25/h9-11,15-16,26-28,37H,3-8,12-14,17-23H2,1-2H3,(H3,33,34,35,38,39)/p+1/t26-,27-,28-/m0/s1 |
| InChIKey | YJPKMSAGXNYABR-KCHLEUMXSA-O |
| XLogP | 4.86 |
| TPSA | 125.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.78 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|