C12H14ClNO3 — CID 107691006
(4-chloropiperidin-1-yl)-(2,6-dihydroxyphenyl)methanone (PubChem CID 107691006) has the molecular formula C12H14ClNO3 and a molecular weight of 255.70 g/mol. Its IUPAC name is (4-chloropiperidin-1-yl)-(2,6-dihydroxyphenyl)methanone.
| Compound Name | (4-chloropiperidin-1-yl)-(2,6-dihydroxyphenyl)methanone |
|---|---|
| PubChem CID | 107691006 |
| Molecular Formula | C12H14ClNO3 |
| Molecular Weight | 255.70 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | (4-chloropiperidin-1-yl)-(2,6-dihydroxyphenyl)methanone |
| SMILES | O=C(c1c(O)cccc1O)N1CCC(Cl)CC1 |
| InChI | InChI=1S/C12H14ClNO3/c13-8-4-6-14(7-5-8)12(17)11-9(15)2-1-3-10(11)16/h1-3,8,15-16H,4-7H2 |
| InChIKey | KVBGJBCSEJEDTM-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.70 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|