C10H9BrF4O — CID 107691579
4-(bromomethyl)-2-fluoro-1-(3,3,3-trifluoropropoxy)benzene (PubChem CID 107691579) has the molecular formula C10H9BrF4O and a molecular weight of 301.08 g/mol. Its IUPAC name is 4-(bromomethyl)-2-fluoro-1-(3,3,3-trifluoropropoxy)benzene.
| Compound Name | 4-(bromomethyl)-2-fluoro-1-(3,3,3-trifluoropropoxy)benzene |
|---|---|
| PubChem CID | 107691579 |
| Molecular Formula | C10H9BrF4O |
| Molecular Weight | 301.08 g/mol |
| Exact Mass | 299.98 |
| IUPAC Name | 4-(bromomethyl)-2-fluoro-1-(3,3,3-trifluoropropoxy)benzene |
| SMILES | Fc1cc(CBr)ccc1OCCC(F)(F)F |
| InChI | InChI=1S/C10H9BrF4O/c11-6-7-1-2-9(8(12)5-7)16-4-3-10(13,14)15/h1-2,5H,3-4,6H2 |
| InChIKey | OPMMIJLSFJSKCU-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.08 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|