C11H13F4NO — CID 82956090
(1R)-1-[3-fluoro-4-(3,3,3-trifluoropropoxy)phenyl]ethanamine (PubChem CID 82956090) has the molecular formula C11H13F4NO and a molecular weight of 251.22 g/mol. Its IUPAC name is (1R)-1-[3-fluoro-4-(3,3,3-trifluoropropoxy)phenyl]ethanamine.
| Compound Name | (1R)-1-[3-fluoro-4-(3,3,3-trifluoropropoxy)phenyl]ethanamine |
|---|---|
| PubChem CID | 82956090 |
| Molecular Formula | C11H13F4NO |
| Molecular Weight | 251.22 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | (1R)-1-[3-fluoro-4-(3,3,3-trifluoropropoxy)phenyl]ethanamine |
| SMILES | C[C@@H](N)c1ccc(OCCC(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C11H13F4NO/c1-7(16)8-2-3-10(9(12)6-8)17-5-4-11(13,14)15/h2-3,6-7H,4-5,16H2,1H3/t7-/m1/s1 |
| InChIKey | JCACNJOWBZWXCJ-SSDOTTSWSA-N |
| XLogP | 3.18 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.22 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |