C13H18FNO — CID 114471761
1-[3-fluoro-4-(3-methylbut-3-enoxy)phenyl]ethanamine (PubChem CID 114471761) has the molecular formula C13H18FNO and a molecular weight of 223.29 g/mol. Its IUPAC name is 1-[3-fluoro-4-(3-methylbut-3-enoxy)phenyl]ethanamine.
| Compound Name | 1-[3-fluoro-4-(3-methylbut-3-enoxy)phenyl]ethanamine |
|---|---|
| PubChem CID | 114471761 |
| Molecular Formula | C13H18FNO |
| Molecular Weight | 223.29 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | 1-[3-fluoro-4-(3-methylbut-3-enoxy)phenyl]ethanamine |
| SMILES | C=C(C)CCOc1ccc(C(C)N)cc1F |
| InChI | InChI=1S/C13H18FNO/c1-9(2)6-7-16-13-5-4-11(10(3)15)8-12(13)14/h4-5,8,10H,1,6-7,15H2,2-3H3 |
| InChIKey | GAGXXAWKGVLPOX-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.29 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|