C13H15FN2OS — CID 107693106
1-[3-fluoro-4-(1,3-thiazol-4-ylmethoxy)phenyl]propan-2-amine (PubChem CID 107693106) has the molecular formula C13H15FN2OS and a molecular weight of 266.34 g/mol. Its IUPAC name is 1-[3-fluoro-4-(1,3-thiazol-4-ylmethoxy)phenyl]propan-2-amine.
| Compound Name | 1-[3-fluoro-4-(1,3-thiazol-4-ylmethoxy)phenyl]propan-2-amine |
|---|---|
| PubChem CID | 107693106 |
| Molecular Formula | C13H15FN2OS |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 1-[3-fluoro-4-(1,3-thiazol-4-ylmethoxy)phenyl]propan-2-amine |
| SMILES | CC(N)Cc1ccc(OCc2cscn2)c(F)c1 |
| InChI | InChI=1S/C13H15FN2OS/c1-9(15)4-10-2-3-13(12(14)5-10)17-6-11-7-18-8-16-11/h2-3,5,7-9H,4,6,15H2,1H3 |
| InChIKey | XZMAUXMVHXLJHK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |