C12H13ClN2OS — CID 62072333
1-[5-chloro-2-(1,3-thiazol-4-ylmethoxy)phenyl]ethanamine (PubChem CID 62072333) has the molecular formula C12H13ClN2OS and a molecular weight of 268.77 g/mol. Its IUPAC name is 1-[5-chloro-2-(1,3-thiazol-4-ylmethoxy)phenyl]ethanamine.
| Compound Name | 1-[5-chloro-2-(1,3-thiazol-4-ylmethoxy)phenyl]ethanamine |
|---|---|
| PubChem CID | 62072333 |
| Molecular Formula | C12H13ClN2OS |
| Molecular Weight | 268.77 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | 1-[5-chloro-2-(1,3-thiazol-4-ylmethoxy)phenyl]ethanamine |
| SMILES | CC(N)c1cc(Cl)ccc1OCc1cscn1 |
| InChI | InChI=1S/C12H13ClN2OS/c1-8(14)11-4-9(13)2-3-12(11)16-5-10-6-17-7-15-10/h2-4,6-8H,5,14H2,1H3 |
| InChIKey | WDIDPLYIPGCYRU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.77 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |