C28H50O4Sn — CID 10769359
dimethyl (4E)-3-(2-methylpent-4-en-2-yl)-4-(tributylstannylmethylidene)cyclopentane-1,1-dicarboxylate (PubChem CID 10769359) has the molecular formula C28H50O4Sn and a molecular weight of 569.42 g/mol. Its IUPAC name is dimethyl (4E)-3-(2-methylpent-4-en-2-yl)-4-(tributylstannylmethylidene)cyclopentane-1,1-dicarboxylate.
| Compound Name | dimethyl (4E)-3-(2-methylpent-4-en-2-yl)-4-(tributylstannylmethylidene)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 10769359 |
| Molecular Formula | C28H50O4Sn |
| Molecular Weight | 569.42 g/mol |
| Exact Mass | 570.27 |
| IUPAC Name | dimethyl (4E)-3-(2-methylpent-4-en-2-yl)-4-(tributylstannylmethylidene)cyclopentane-1,1-dicarboxylate |
| SMILES | C=CCC(C)(C)C1CC(C(=O)OC)(C(=O)OC)C/C1=C\[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C16H23O4.3C4H9.Sn/c1-7-8-15(3,4)12-10-16(9-11(12)2,13(17)19-5)14(18)20-6;3*1-3-4-2;/h2,7,12H,1,8-10H2,3-6H3;3*1,3-4H2,2H3; |
| InChIKey | QGROSQREOLZHRK-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.42 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|