C15H24FNOS — CID 107696513
N-[[5-fluoro-2-(3-methylsulfanylpropoxy)phenyl]methyl]-2-methylpropan-2-amine (PubChem CID 107696513) has the molecular formula C15H24FNOS and a molecular weight of 285.43 g/mol. Its IUPAC name is N-[[5-fluoro-2-(3-methylsulfanylpropoxy)phenyl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[5-fluoro-2-(3-methylsulfanylpropoxy)phenyl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 107696513 |
| Molecular Formula | C15H24FNOS |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | N-[[5-fluoro-2-(3-methylsulfanylpropoxy)phenyl]methyl]-2-methylpropan-2-amine |
| SMILES | CSCCCOc1ccc(F)cc1CNC(C)(C)C |
| InChI | InChI=1S/C15H24FNOS/c1-15(2,3)17-11-12-10-13(16)6-7-14(12)18-8-5-9-19-4/h6-7,10,17H,5,8-9,11H2,1-4H3 |
| InChIKey | ZBAMYHBMFMYADX-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|