C28H26ClFN2O5S2 — CID 10769704
methyl 1-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]-2-oxo-4-phenyl-6-(4-sulfamoylphenyl)-3,4-dihydropyridine-3-carboxylate (PubChem CID 10769704) has the molecular formula C28H26ClFN2O5S2 and a molecular weight of 589.11 g/mol. Its IUPAC name is methyl 1-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]-2-oxo-4-phenyl-6-(4-sulfamoylphenyl)-3,4-dihydropyridine-3-carboxylate.
| Compound Name | methyl 1-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]-2-oxo-4-phenyl-6-(4-sulfamoylphenyl)-3,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 10769704 |
| Molecular Formula | C28H26ClFN2O5S2 |
| Molecular Weight | 589.11 g/mol |
| Exact Mass | 588.10 |
| IUPAC Name | methyl 1-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]-2-oxo-4-phenyl-6-(4-sulfamoylphenyl)-3,4-dihydropyridine-3-carboxylate |
| SMILES | COC(=O)C1C(=O)N(CCSCc2c(F)cccc2Cl)C(c2ccc(S(N)(=O)=O)cc2)=CC1c1ccccc1 |
| InChI | InChI=1S/C28H26ClFN2O5S2/c1-37-28(34)26-21(18-6-3-2-4-7-18)16-25(19-10-12-20(13-11-19)39(31,35)36)32(27(26)33)14-15-38-17-22-23(29)8-5-9-24(22)30/h2-13,16,21,26H,14-15,17H2,1H3,(H2,31,35,36) |
| InChIKey | NCSADZRKONBGCI-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.11 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|