C30H28ClFN2O5S2 — CID 10817574
prop-2-enyl 1-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]-2-oxo-4-phenyl-6-(4-sulfamoylphenyl)-3,4-dihydropyridine-3-carboxylate (PubChem CID 10817574) has the molecular formula C30H28ClFN2O5S2 and a molecular weight of 615.15 g/mol. Its IUPAC name is prop-2-enyl 1-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]-2-oxo-4-phenyl-6-(4-sulfamoylphenyl)-3,4-dihydropyridine-3-carboxylate.
| Compound Name | prop-2-enyl 1-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]-2-oxo-4-phenyl-6-(4-sulfamoylphenyl)-3,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 10817574 |
| Molecular Formula | C30H28ClFN2O5S2 |
| Molecular Weight | 615.15 g/mol |
| Exact Mass | 614.11 |
| IUPAC Name | prop-2-enyl 1-[2-[(2-chloro-6-fluorophenyl)methylsulfanyl]ethyl]-2-oxo-4-phenyl-6-(4-sulfamoylphenyl)-3,4-dihydropyridine-3-carboxylate |
| SMILES | C=CCOC(=O)C1C(=O)N(CCSCc2c(F)cccc2Cl)C(c2ccc(S(N)(=O)=O)cc2)=CC1c1ccccc1 |
| InChI | InChI=1S/C30H28ClFN2O5S2/c1-2-16-39-30(36)28-23(20-7-4-3-5-8-20)18-27(21-11-13-22(14-12-21)41(33,37)38)34(29(28)35)15-17-40-19-24-25(31)9-6-10-26(24)32/h2-14,18,23,28H,1,15-17,19H2,(H2,33,37,38) |
| InChIKey | IGYDOAVZQUPUBV-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.15 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|