C28H26N2O5S — CID 10744043
prop-2-enyl 1-benzyl-2-oxo-4-phenyl-6-(4-sulfamoylphenyl)-3,4-dihydropyridine-3-carboxylate (PubChem CID 10744043) has the molecular formula C28H26N2O5S and a molecular weight of 502.59 g/mol. Its IUPAC name is prop-2-enyl 1-benzyl-2-oxo-4-phenyl-6-(4-sulfamoylphenyl)-3,4-dihydropyridine-3-carboxylate.
| Compound Name | prop-2-enyl 1-benzyl-2-oxo-4-phenyl-6-(4-sulfamoylphenyl)-3,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 10744043 |
| Molecular Formula | C28H26N2O5S |
| Molecular Weight | 502.59 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | prop-2-enyl 1-benzyl-2-oxo-4-phenyl-6-(4-sulfamoylphenyl)-3,4-dihydropyridine-3-carboxylate |
| SMILES | C=CCOC(=O)C1C(=O)N(Cc2ccccc2)C(c2ccc(S(N)(=O)=O)cc2)=CC1c1ccccc1 |
| InChI | InChI=1S/C28H26N2O5S/c1-2-17-35-28(32)26-24(21-11-7-4-8-12-21)18-25(22-13-15-23(16-14-22)36(29,33)34)30(27(26)31)19-20-9-5-3-6-10-20/h2-16,18,24,26H,1,17,19H2,(H2,29,33,34) |
| InChIKey | LLRUAFQPQKEEPH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.59 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|