C19H18N2O5S — CID 10667858
methyl 2-oxo-4-phenyl-6-(4-sulfamoylphenyl)-3,4-dihydro-1H-pyridine-3-carboxylate (PubChem CID 10667858) has the molecular formula C19H18N2O5S and a molecular weight of 386.43 g/mol. Its IUPAC name is methyl 2-oxo-4-phenyl-6-(4-sulfamoylphenyl)-3,4-dihydro-1H-pyridine-3-carboxylate.
| Compound Name | methyl 2-oxo-4-phenyl-6-(4-sulfamoylphenyl)-3,4-dihydro-1H-pyridine-3-carboxylate |
|---|---|
| PubChem CID | 10667858 |
| Molecular Formula | C19H18N2O5S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | methyl 2-oxo-4-phenyl-6-(4-sulfamoylphenyl)-3,4-dihydro-1H-pyridine-3-carboxylate |
| SMILES | COC(=O)C1C(=O)NC(c2ccc(S(N)(=O)=O)cc2)=CC1c1ccccc1 |
| InChI | InChI=1S/C19H18N2O5S/c1-26-19(23)17-15(12-5-3-2-4-6-12)11-16(21-18(17)22)13-7-9-14(10-8-13)27(20,24)25/h2-11,15,17H,1H3,(H,21,22)(H2,20,24,25) |
| InChIKey | VKLPQPYUXIRNJT-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|