C27H26FNO6S — CID 102224654
dimethyl 2-[(E,1R)-3-(2-fluorophenyl)-3-[(4-methylphenyl)sulfonylamino]-1-phenylprop-2-enyl]propanedioate (PubChem CID 102224654) has the molecular formula C27H26FNO6S and a molecular weight of 511.57 g/mol. Its IUPAC name is dimethyl 2-[(E,1R)-3-(2-fluorophenyl)-3-[(4-methylphenyl)sulfonylamino]-1-phenylprop-2-enyl]propanedioate.
| Compound Name | dimethyl 2-[(E,1R)-3-(2-fluorophenyl)-3-[(4-methylphenyl)sulfonylamino]-1-phenylprop-2-enyl]propanedioate |
|---|---|
| PubChem CID | 102224654 |
| Molecular Formula | C27H26FNO6S |
| Molecular Weight | 511.57 g/mol |
| Exact Mass | 511.15 |
| IUPAC Name | dimethyl 2-[(E,1R)-3-(2-fluorophenyl)-3-[(4-methylphenyl)sulfonylamino]-1-phenylprop-2-enyl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)[C@@H](/C=C(/NS(=O)(=O)c1ccc(C)cc1)c1ccccc1F)c1ccccc1 |
| InChI | InChI=1S/C27H26FNO6S/c1-18-13-15-20(16-14-18)36(32,33)29-24(21-11-7-8-12-23(21)28)17-22(19-9-5-4-6-10-19)25(26(30)34-2)27(31)35-3/h4-17,22,25,29H,1-3H3/b24-17+/t22-/m0/s1 |
| InChIKey | PFOLQVYJYPCCIP-ZRZWOPFXSA-N |
| XLogP | 4.20 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.57 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|