C26H24F3NO6S — CID 134962092
dimethyl 2-[(E,2S)-1,1,1-trifluoro-4-[(4-methylphenyl)sulfonylamino]-4-naphthalen-2-ylbut-3-en-2-yl]propanedioate (PubChem CID 134962092) has the molecular formula C26H24F3NO6S and a molecular weight of 535.54 g/mol. Its IUPAC name is dimethyl 2-[(E,2S)-1,1,1-trifluoro-4-[(4-methylphenyl)sulfonylamino]-4-naphthalen-2-ylbut-3-en-2-yl]propanedioate.
| Compound Name | dimethyl 2-[(E,2S)-1,1,1-trifluoro-4-[(4-methylphenyl)sulfonylamino]-4-naphthalen-2-ylbut-3-en-2-yl]propanedioate |
|---|---|
| PubChem CID | 134962092 |
| Molecular Formula | C26H24F3NO6S |
| Molecular Weight | 535.54 g/mol |
| Exact Mass | 535.13 |
| IUPAC Name | dimethyl 2-[(E,2S)-1,1,1-trifluoro-4-[(4-methylphenyl)sulfonylamino]-4-naphthalen-2-ylbut-3-en-2-yl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)[C@H](/C=C(/NS(=O)(=O)c1ccc(C)cc1)c1ccc2ccccc2c1)C(F)(F)F |
| InChI | InChI=1S/C26H24F3NO6S/c1-16-8-12-20(13-9-16)37(33,34)30-22(19-11-10-17-6-4-5-7-18(17)14-19)15-21(26(27,28)29)23(24(31)35-2)25(32)36-3/h4-15,21,23,30H,1-3H3/b22-15+/t21-/m0/s1 |
| InChIKey | LWOXMHZVZYAHMY-FNNTWHHHSA-N |
| XLogP | 4.61 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.54 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|