C24H24FNO4S — CID 10836885
methyl 4-[4-[[(4-fluorophenyl)sulfonylamino]-phenylmethyl]phenyl]butanoate (PubChem CID 10836885) has the molecular formula C24H24FNO4S and a molecular weight of 441.52 g/mol. Its IUPAC name is methyl 4-[4-[[(4-fluorophenyl)sulfonylamino]-phenylmethyl]phenyl]butanoate.
| Compound Name | methyl 4-[4-[[(4-fluorophenyl)sulfonylamino]-phenylmethyl]phenyl]butanoate |
|---|---|
| PubChem CID | 10836885 |
| Molecular Formula | C24H24FNO4S |
| Molecular Weight | 441.52 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | methyl 4-[4-[[(4-fluorophenyl)sulfonylamino]-phenylmethyl]phenyl]butanoate |
| SMILES | COC(=O)CCCc1ccc(C(NS(=O)(=O)c2ccc(F)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H24FNO4S/c1-30-23(27)9-5-6-18-10-12-20(13-11-18)24(19-7-3-2-4-8-19)26-31(28,29)22-16-14-21(25)15-17-22/h2-4,7-8,10-17,24,26H,5-6,9H2,1H3 |
| InChIKey | OTLHXQMTMPHQEI-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.52 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |