C26H28FNO4S — CID 23353793
methyl 4-[4-[1-[(4-fluorophenyl)sulfonylamino]-3-phenylpropyl]phenyl]butanoate (PubChem CID 23353793) has the molecular formula C26H28FNO4S and a molecular weight of 469.58 g/mol. Its IUPAC name is methyl 4-[4-[1-[(4-fluorophenyl)sulfonylamino]-3-phenylpropyl]phenyl]butanoate.
| Compound Name | methyl 4-[4-[1-[(4-fluorophenyl)sulfonylamino]-3-phenylpropyl]phenyl]butanoate |
|---|---|
| PubChem CID | 23353793 |
| Molecular Formula | C26H28FNO4S |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | methyl 4-[4-[1-[(4-fluorophenyl)sulfonylamino]-3-phenylpropyl]phenyl]butanoate |
| SMILES | COC(=O)CCCc1ccc(C(CCc2ccccc2)NS(=O)(=O)c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C26H28FNO4S/c1-32-26(29)9-5-8-21-10-13-22(14-11-21)25(19-12-20-6-3-2-4-7-20)28-33(30,31)24-17-15-23(27)16-18-24/h2-4,6-7,10-11,13-18,25,28H,5,8-9,12,19H2,1H3 |
| InChIKey | HAYAWLYHKQPSTD-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |