C22H24F3NO6S — CID 132506682
dimethyl 2-[(2S,4R)-1,1,1-trifluoro-4-[(4-methylphenyl)sulfonylamino]-4-phenylbutan-2-yl]propanedioate (PubChem CID 132506682) has the molecular formula C22H24F3NO6S and a molecular weight of 487.50 g/mol. Its IUPAC name is dimethyl 2-[(2S,4R)-1,1,1-trifluoro-4-[(4-methylphenyl)sulfonylamino]-4-phenylbutan-2-yl]propanedioate.
| Compound Name | dimethyl 2-[(2S,4R)-1,1,1-trifluoro-4-[(4-methylphenyl)sulfonylamino]-4-phenylbutan-2-yl]propanedioate |
|---|---|
| PubChem CID | 132506682 |
| Molecular Formula | C22H24F3NO6S |
| Molecular Weight | 487.50 g/mol |
| Exact Mass | 487.13 |
| IUPAC Name | dimethyl 2-[(2S,4R)-1,1,1-trifluoro-4-[(4-methylphenyl)sulfonylamino]-4-phenylbutan-2-yl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)[C@H](C[C@@H](NS(=O)(=O)c1ccc(C)cc1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C22H24F3NO6S/c1-14-9-11-16(12-10-14)33(29,30)26-18(15-7-5-4-6-8-15)13-17(22(23,24)25)19(20(27)31-2)21(28)32-3/h4-12,17-19,26H,13H2,1-3H3/t17-,18+/m0/s1 |
| InChIKey | FDYKTYLTSOJUSH-ZWKOTPCHSA-N |
| XLogP | 3.55 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.50 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|