C21H20F3NO5S — CID 132506678
methyl (3R,4S,6R)-1-(4-methylphenyl)sulfonyl-2-oxo-6-phenyl-4-(trifluoromethyl)piperidine-3-carboxylate (PubChem CID 132506678) has the molecular formula C21H20F3NO5S and a molecular weight of 455.45 g/mol. Its IUPAC name is methyl (3R,4S,6R)-1-(4-methylphenyl)sulfonyl-2-oxo-6-phenyl-4-(trifluoromethyl)piperidine-3-carboxylate.
| Compound Name | methyl (3R,4S,6R)-1-(4-methylphenyl)sulfonyl-2-oxo-6-phenyl-4-(trifluoromethyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 132506678 |
| Molecular Formula | C21H20F3NO5S |
| Molecular Weight | 455.45 g/mol |
| Exact Mass | 455.10 |
| IUPAC Name | methyl (3R,4S,6R)-1-(4-methylphenyl)sulfonyl-2-oxo-6-phenyl-4-(trifluoromethyl)piperidine-3-carboxylate |
| SMILES | COC(=O)[C@H]1C(=O)N(S(=O)(=O)c2ccc(C)cc2)[C@@H](c2ccccc2)C[C@@H]1C(F)(F)F |
| InChI | InChI=1S/C21H20F3NO5S/c1-13-8-10-15(11-9-13)31(28,29)25-17(14-6-4-3-5-7-14)12-16(21(22,23)24)18(19(25)26)20(27)30-2/h3-11,16-18H,12H2,1-2H3/t16-,17+,18+/m0/s1 |
| InChIKey | AKMKRCHAWPBKCD-RCCFBDPRSA-N |
| XLogP | 3.63 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|