C21H23NO5S — CID 177217653
methyl 2-[1-(4-methylphenyl)sulfonyl-6-oxo-5-phenylpiperidin-2-yl]acetate (PubChem CID 177217653) has the molecular formula C21H23NO5S and a molecular weight of 401.48 g/mol. Its IUPAC name is methyl 2-[1-(4-methylphenyl)sulfonyl-6-oxo-5-phenylpiperidin-2-yl]acetate.
| Compound Name | methyl 2-[1-(4-methylphenyl)sulfonyl-6-oxo-5-phenylpiperidin-2-yl]acetate |
|---|---|
| PubChem CID | 177217653 |
| Molecular Formula | C21H23NO5S |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | methyl 2-[1-(4-methylphenyl)sulfonyl-6-oxo-5-phenylpiperidin-2-yl]acetate |
| SMILES | COC(=O)CC1CCC(c2ccccc2)C(=O)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H23NO5S/c1-15-8-11-18(12-9-15)28(25,26)22-17(14-20(23)27-2)10-13-19(21(22)24)16-6-4-3-5-7-16/h3-9,11-12,17,19H,10,13-14H2,1-2H3 |
| InChIKey | CEAKGMPKPVWVJH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |