C19H27NO5S — CID 177217739
methyl 2-[5-tert-butyl-1-(4-methylphenyl)sulfonyl-6-oxopiperidin-2-yl]acetate (PubChem CID 177217739) has the molecular formula C19H27NO5S and a molecular weight of 381.49 g/mol. Its IUPAC name is methyl 2-[5-tert-butyl-1-(4-methylphenyl)sulfonyl-6-oxopiperidin-2-yl]acetate.
| Compound Name | methyl 2-[5-tert-butyl-1-(4-methylphenyl)sulfonyl-6-oxopiperidin-2-yl]acetate |
|---|---|
| PubChem CID | 177217739 |
| Molecular Formula | C19H27NO5S |
| Molecular Weight | 381.49 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | methyl 2-[5-tert-butyl-1-(4-methylphenyl)sulfonyl-6-oxopiperidin-2-yl]acetate |
| SMILES | COC(=O)CC1CCC(C(C)(C)C)C(=O)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C19H27NO5S/c1-13-6-9-15(10-7-13)26(23,24)20-14(12-17(21)25-5)8-11-16(18(20)22)19(2,3)4/h6-7,9-10,14,16H,8,11-12H2,1-5H3 |
| InChIKey | YLBVBMMBVJVPTM-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.49 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |