C20H21NO5S — CID 177217617
methyl 2-[1-(4-methylphenyl)sulfonyl-5-oxo-4-phenylpyrrolidin-2-yl]acetate (PubChem CID 177217617) has the molecular formula C20H21NO5S and a molecular weight of 387.46 g/mol. Its IUPAC name is methyl 2-[1-(4-methylphenyl)sulfonyl-5-oxo-4-phenylpyrrolidin-2-yl]acetate.
| Compound Name | methyl 2-[1-(4-methylphenyl)sulfonyl-5-oxo-4-phenylpyrrolidin-2-yl]acetate |
|---|---|
| PubChem CID | 177217617 |
| Molecular Formula | C20H21NO5S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | methyl 2-[1-(4-methylphenyl)sulfonyl-5-oxo-4-phenylpyrrolidin-2-yl]acetate |
| SMILES | COC(=O)CC1CC(c2ccccc2)C(=O)N1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H21NO5S/c1-14-8-10-17(11-9-14)27(24,25)21-16(13-19(22)26-2)12-18(20(21)23)15-6-4-3-5-7-15/h3-11,16,18H,12-13H2,1-2H3 |
| InChIKey | JLGKTFOGZALZSE-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |