C25H28F3N3O6S — CID 90747735
methyl 3-[4-[4-acetyl-2-[benzyl(trifluoromethyl)carbamoyl]piperazin-1-yl]sulfonylphenyl]propanoate (PubChem CID 90747735) has the molecular formula C25H28F3N3O6S and a molecular weight of 555.58 g/mol. Its IUPAC name is methyl 3-[4-[4-acetyl-2-[benzyl(trifluoromethyl)carbamoyl]piperazin-1-yl]sulfonylphenyl]propanoate.
| Compound Name | methyl 3-[4-[4-acetyl-2-[benzyl(trifluoromethyl)carbamoyl]piperazin-1-yl]sulfonylphenyl]propanoate |
|---|---|
| PubChem CID | 90747735 |
| Molecular Formula | C25H28F3N3O6S |
| Molecular Weight | 555.58 g/mol |
| Exact Mass | 555.17 |
| IUPAC Name | methyl 3-[4-[4-acetyl-2-[benzyl(trifluoromethyl)carbamoyl]piperazin-1-yl]sulfonylphenyl]propanoate |
| SMILES | COC(=O)CCc1ccc(S(=O)(=O)N2CCN(C(C)=O)CC2C(=O)N(Cc2ccccc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C25H28F3N3O6S/c1-18(32)29-14-15-31(38(35,36)21-11-8-19(9-12-21)10-13-23(33)37-2)22(17-29)24(34)30(25(26,27)28)16-20-6-4-3-5-7-20/h3-9,11-12,22H,10,13-17H2,1-2H3 |
| InChIKey | RXFBNDZYHIADNY-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 104.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.58 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|