C26H22F5NO6S2 — CID 154717510
dimethyl 2-[2-[(4-methylphenyl)sulfonylamino]-2-(2,3,4,5,6-pentafluorophenyl)ethyl]-2-phenylsulfanylpropanedioate (PubChem CID 154717510) has the molecular formula C26H22F5NO6S2 and a molecular weight of 603.59 g/mol. Its IUPAC name is dimethyl 2-[2-[(4-methylphenyl)sulfonylamino]-2-(2,3,4,5,6-pentafluorophenyl)ethyl]-2-phenylsulfanylpropanedioate.
| Compound Name | dimethyl 2-[2-[(4-methylphenyl)sulfonylamino]-2-(2,3,4,5,6-pentafluorophenyl)ethyl]-2-phenylsulfanylpropanedioate |
|---|---|
| PubChem CID | 154717510 |
| Molecular Formula | C26H22F5NO6S2 |
| Molecular Weight | 603.59 g/mol |
| Exact Mass | 603.08 |
| IUPAC Name | dimethyl 2-[2-[(4-methylphenyl)sulfonylamino]-2-(2,3,4,5,6-pentafluorophenyl)ethyl]-2-phenylsulfanylpropanedioate |
| SMILES | COC(=O)C(CC(NS(=O)(=O)c1ccc(C)cc1)c1c(F)c(F)c(F)c(F)c1F)(Sc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C26H22F5NO6S2/c1-14-9-11-16(12-10-14)40(35,36)32-17(18-19(27)21(29)23(31)22(30)20(18)28)13-26(24(33)37-2,25(34)38-3)39-15-7-5-4-6-8-15/h4-12,17,32H,13H2,1-3H3 |
| InChIKey | VCQXRUSFNXBNME-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.59 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|