C23H26F3NO6S — CID 134954870
diethyl 2-[(4-methylphenyl)sulfonylamino]-2-(3,3,3-trifluoro-2-phenylpropyl)propanedioate (PubChem CID 134954870) has the molecular formula C23H26F3NO6S and a molecular weight of 501.52 g/mol. Its IUPAC name is diethyl 2-[(4-methylphenyl)sulfonylamino]-2-(3,3,3-trifluoro-2-phenylpropyl)propanedioate.
| Compound Name | diethyl 2-[(4-methylphenyl)sulfonylamino]-2-(3,3,3-trifluoro-2-phenylpropyl)propanedioate |
|---|---|
| PubChem CID | 134954870 |
| Molecular Formula | C23H26F3NO6S |
| Molecular Weight | 501.52 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | diethyl 2-[(4-methylphenyl)sulfonylamino]-2-(3,3,3-trifluoro-2-phenylpropyl)propanedioate |
| SMILES | CCOC(=O)C(CC(c1ccccc1)C(F)(F)F)(NS(=O)(=O)c1ccc(C)cc1)C(=O)OCC |
| InChI | InChI=1S/C23H26F3NO6S/c1-4-32-20(28)22(21(29)33-5-2,27-34(30,31)18-13-11-16(3)12-14-18)15-19(23(24,25)26)17-9-7-6-8-10-17/h6-14,19,27H,4-5,15H2,1-3H3 |
| InChIKey | KGUXFCRTOOSSJQ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.52 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|