C22H22N2O5S — CID 10836184
methyl 2-oxo-4-phenyl-1-prop-2-enyl-6-(4-sulfamoylphenyl)-3,4-dihydropyridine-3-carboxylate (PubChem CID 10836184) has the molecular formula C22H22N2O5S and a molecular weight of 426.49 g/mol. Its IUPAC name is methyl 2-oxo-4-phenyl-1-prop-2-enyl-6-(4-sulfamoylphenyl)-3,4-dihydropyridine-3-carboxylate.
| Compound Name | methyl 2-oxo-4-phenyl-1-prop-2-enyl-6-(4-sulfamoylphenyl)-3,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 10836184 |
| Molecular Formula | C22H22N2O5S |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | methyl 2-oxo-4-phenyl-1-prop-2-enyl-6-(4-sulfamoylphenyl)-3,4-dihydropyridine-3-carboxylate |
| SMILES | C=CCN1C(=O)C(C(=O)OC)C(c2ccccc2)C=C1c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C22H22N2O5S/c1-3-13-24-19(16-9-11-17(12-10-16)30(23,27)28)14-18(15-7-5-4-6-8-15)20(21(24)25)22(26)29-2/h3-12,14,18,20H,1,13H2,2H3,(H2,23,27,28) |
| InChIKey | GDSGHUMJHYMESF-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|