C12H12FNO4 — CID 107699649
(E)-3-[2-(1-amino-1-oxopropan-2-yl)oxy-5-fluorophenyl]prop-2-enoic acid (PubChem CID 107699649) has the molecular formula C12H12FNO4 and a molecular weight of 253.23 g/mol. Its IUPAC name is (E)-3-[2-(1-amino-1-oxopropan-2-yl)oxy-5-fluorophenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-(1-amino-1-oxopropan-2-yl)oxy-5-fluorophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 107699649 |
| Molecular Formula | C12H12FNO4 |
| Molecular Weight | 253.23 g/mol |
| Exact Mass | 253.08 |
| IUPAC Name | (E)-3-[2-(1-amino-1-oxopropan-2-yl)oxy-5-fluorophenyl]prop-2-enoic acid |
| SMILES | CC(Oc1ccc(F)cc1/C=C/C(=O)O)C(N)=O |
| InChI | InChI=1S/C12H12FNO4/c1-7(12(14)17)18-10-4-3-9(13)6-8(10)2-5-11(15)16/h2-7H,1H3,(H2,14,17)(H,15,16)/b5-2+ |
| InChIKey | HYOHKKPCUZQGTB-GORDUTHDSA-N |
| XLogP | 1.18 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.23 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|