C15H20FNO — CID 107701484
1-(5-fluoro-2-pent-4-ynoxyphenyl)butan-2-amine (PubChem CID 107701484) has the molecular formula C15H20FNO and a molecular weight of 249.33 g/mol. Its IUPAC name is 1-(5-fluoro-2-pent-4-ynoxyphenyl)butan-2-amine.
| Compound Name | 1-(5-fluoro-2-pent-4-ynoxyphenyl)butan-2-amine |
|---|---|
| PubChem CID | 107701484 |
| Molecular Formula | C15H20FNO |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 1-(5-fluoro-2-pent-4-ynoxyphenyl)butan-2-amine |
| SMILES | C#CCCCOc1ccc(F)cc1CC(N)CC |
| InChI | InChI=1S/C15H20FNO/c1-3-5-6-9-18-15-8-7-13(16)10-12(15)11-14(17)4-2/h1,7-8,10,14H,4-6,9,11,17H2,2H3 |
| InChIKey | OLDQVZQALLIQMB-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|