C16H26FNO3 — CID 107701721
1-[5-fluoro-2-[3-(2-methoxyethoxy)propoxy]phenyl]butan-2-amine (PubChem CID 107701721) has the molecular formula C16H26FNO3 and a molecular weight of 299.39 g/mol. Its IUPAC name is 1-[5-fluoro-2-[3-(2-methoxyethoxy)propoxy]phenyl]butan-2-amine.
| Compound Name | 1-[5-fluoro-2-[3-(2-methoxyethoxy)propoxy]phenyl]butan-2-amine |
|---|---|
| PubChem CID | 107701721 |
| Molecular Formula | C16H26FNO3 |
| Molecular Weight | 299.39 g/mol |
| Exact Mass | 299.19 |
| IUPAC Name | 1-[5-fluoro-2-[3-(2-methoxyethoxy)propoxy]phenyl]butan-2-amine |
| SMILES | CCC(N)Cc1cc(F)ccc1OCCCOCCOC |
| InChI | InChI=1S/C16H26FNO3/c1-3-15(18)12-13-11-14(17)5-6-16(13)21-8-4-7-20-10-9-19-2/h5-6,11,15H,3-4,7-10,12,18H2,1-2H3 |
| InChIKey | AVPKEUWRFOUKDR-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.39 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|