C12H24N2O2 — CID 107703590
N-cyclopropyl-2-(6-hydroxyhexylamino)propanamide (PubChem CID 107703590) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is N-cyclopropyl-2-(6-hydroxyhexylamino)propanamide.
| Compound Name | N-cyclopropyl-2-(6-hydroxyhexylamino)propanamide |
|---|---|
| PubChem CID | 107703590 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | N-cyclopropyl-2-(6-hydroxyhexylamino)propanamide |
| SMILES | CC(NCCCCCCO)C(=O)NC1CC1 |
| InChI | InChI=1S/C12H24N2O2/c1-10(12(16)14-11-6-7-11)13-8-4-2-3-5-9-15/h10-11,13,15H,2-9H2,1H3,(H,14,16) |
| InChIKey | YDBQRXDNGIQKRK-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|