C12H23N3O — CID 107703692
6-[2-(2-methylpyrazol-3-yl)ethylamino]hexan-1-ol (PubChem CID 107703692) has the molecular formula C12H23N3O and a molecular weight of 225.34 g/mol. Its IUPAC name is 6-[2-(2-methylpyrazol-3-yl)ethylamino]hexan-1-ol.
| Compound Name | 6-[2-(2-methylpyrazol-3-yl)ethylamino]hexan-1-ol |
|---|---|
| PubChem CID | 107703692 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | 6-[2-(2-methylpyrazol-3-yl)ethylamino]hexan-1-ol |
| SMILES | Cn1nccc1CCNCCCCCCO |
| InChI | InChI=1S/C12H23N3O/c1-15-12(7-10-14-15)6-9-13-8-4-2-3-5-11-16/h7,10,13,16H,2-6,8-9,11H2,1H3 |
| InChIKey | XBEWKEGETBIZON-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|