C16H16N2O2 — CID 107704465
5-(1-propylbenzimidazol-2-yl)benzene-1,3-diol (PubChem CID 107704465) has the molecular formula C16H16N2O2 and a molecular weight of 268.32 g/mol. Its IUPAC name is 5-(1-propylbenzimidazol-2-yl)benzene-1,3-diol.
| Compound Name | 5-(1-propylbenzimidazol-2-yl)benzene-1,3-diol |
|---|---|
| PubChem CID | 107704465 |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.12 |
| IUPAC Name | 5-(1-propylbenzimidazol-2-yl)benzene-1,3-diol |
| SMILES | CCCn1c(-c2cc(O)cc(O)c2)nc2ccccc21 |
| InChI | InChI=1S/C16H16N2O2/c1-2-7-18-15-6-4-3-5-14(15)17-16(18)11-8-12(19)10-13(20)9-11/h3-6,8-10,19-20H,2,7H2,1H3 |
| InChIKey | BSHUOGIFAAGUOI-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |