C17H18N2O3 — CID 135574032
4-(1-ethylbenzimidazol-2-yl)-2,6-dimethoxyphenol (PubChem CID 135574032) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is 4-(1-ethylbenzimidazol-2-yl)-2,6-dimethoxyphenol.
| Compound Name | 4-(1-ethylbenzimidazol-2-yl)-2,6-dimethoxyphenol |
|---|---|
| PubChem CID | 135574032 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 4-(1-ethylbenzimidazol-2-yl)-2,6-dimethoxyphenol |
| SMILES | CCn1c(-c2cc(OC)c(O)c(OC)c2)nc2ccccc21 |
| InChI | InChI=1S/C17H18N2O3/c1-4-19-13-8-6-5-7-12(13)18-17(19)11-9-14(21-2)16(20)15(10-11)22-3/h5-10,20H,4H2,1-3H3 |
| InChIKey | SFIPXXDLTPYCHM-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |