C18H17N3O3 — CID 168854483
5-(5-isocyano-1-propylbenzimidazol-2-yl)-3-methoxybenzene-1,2-diol (PubChem CID 168854483) has the molecular formula C18H17N3O3 and a molecular weight of 323.35 g/mol. Its IUPAC name is 5-(5-isocyano-1-propylbenzimidazol-2-yl)-3-methoxybenzene-1,2-diol.
| Compound Name | 5-(5-isocyano-1-propylbenzimidazol-2-yl)-3-methoxybenzene-1,2-diol |
|---|---|
| PubChem CID | 168854483 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 5-(5-isocyano-1-propylbenzimidazol-2-yl)-3-methoxybenzene-1,2-diol |
| SMILES | [C-]#[N+]c1ccc2c(c1)nc(-c1cc(O)c(O)c(OC)c1)n2CCC |
| InChI | InChI=1S/C18H17N3O3/c1-4-7-21-14-6-5-12(19-2)10-13(14)20-18(21)11-8-15(22)17(23)16(9-11)24-3/h5-6,8-10,22-23H,4,7H2,1,3H3 |
| InChIKey | DGNUNOQMQWZXNH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 71.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|