C19H20N2O4 — CID 39904014
ethyl 1-ethyl-2-(3-hydroxy-4-methoxyphenyl)benzimidazole-5-carboxylate (PubChem CID 39904014) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is ethyl 1-ethyl-2-(3-hydroxy-4-methoxyphenyl)benzimidazole-5-carboxylate.
| Compound Name | ethyl 1-ethyl-2-(3-hydroxy-4-methoxyphenyl)benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 39904014 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | ethyl 1-ethyl-2-(3-hydroxy-4-methoxyphenyl)benzimidazole-5-carboxylate |
| SMILES | CCOC(=O)c1ccc2c(c1)nc(-c1ccc(OC)c(O)c1)n2CC |
| InChI | InChI=1S/C19H20N2O4/c1-4-21-15-8-6-13(19(23)25-5-2)10-14(15)20-18(21)12-7-9-17(24-3)16(22)11-12/h6-11,22H,4-5H2,1-3H3 |
| InChIKey | QECCUUIPQCEZIP-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |