C16H15ClN2O2 — CID 136885662
4-(6-chloro-1-propylbenzimidazol-2-yl)benzene-1,2-diol (PubChem CID 136885662) has the molecular formula C16H15ClN2O2 and a molecular weight of 302.76 g/mol. Its IUPAC name is 4-(6-chloro-1-propylbenzimidazol-2-yl)benzene-1,2-diol.
| Compound Name | 4-(6-chloro-1-propylbenzimidazol-2-yl)benzene-1,2-diol |
|---|---|
| PubChem CID | 136885662 |
| Molecular Formula | C16H15ClN2O2 |
| Molecular Weight | 302.76 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 4-(6-chloro-1-propylbenzimidazol-2-yl)benzene-1,2-diol |
| SMILES | CCCn1c(-c2ccc(O)c(O)c2)nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C16H15ClN2O2/c1-2-7-19-13-9-11(17)4-5-12(13)18-16(19)10-3-6-14(20)15(21)8-10/h3-6,8-9,20-21H,2,7H2,1H3 |
| InChIKey | WWAWTVCMWQUXJE-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.76 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|