C16H18N2O3 — CID 107705147
N-(3-amino-3-phenylpropyl)-3,5-dihydroxybenzamide (PubChem CID 107705147) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is N-(3-amino-3-phenylpropyl)-3,5-dihydroxybenzamide.
| Compound Name | N-(3-amino-3-phenylpropyl)-3,5-dihydroxybenzamide |
|---|---|
| PubChem CID | 107705147 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | N-(3-amino-3-phenylpropyl)-3,5-dihydroxybenzamide |
| SMILES | NC(CCNC(=O)c1cc(O)cc(O)c1)c1ccccc1 |
| InChI | InChI=1S/C16H18N2O3/c17-15(11-4-2-1-3-5-11)6-7-18-16(21)12-8-13(19)10-14(20)9-12/h1-5,8-10,15,19-20H,6-7,17H2,(H,18,21) |
| InChIKey | CAFMEEQYBJVXSS-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |