C15H15F2NO3 — CID 107705148
5-[1-[2-(difluoromethoxy)anilino]ethyl]benzene-1,3-diol (PubChem CID 107705148) has the molecular formula C15H15F2NO3 and a molecular weight of 295.28 g/mol. Its IUPAC name is 5-[1-[2-(difluoromethoxy)anilino]ethyl]benzene-1,3-diol.
| Compound Name | 5-[1-[2-(difluoromethoxy)anilino]ethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 107705148 |
| Molecular Formula | C15H15F2NO3 |
| Molecular Weight | 295.28 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 5-[1-[2-(difluoromethoxy)anilino]ethyl]benzene-1,3-diol |
| SMILES | CC(Nc1ccccc1OC(F)F)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C15H15F2NO3/c1-9(10-6-11(19)8-12(20)7-10)18-13-4-2-3-5-14(13)21-15(16)17/h2-9,15,18-20H,1H3 |
| InChIKey | NKUGXEWIZYPZBU-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.28 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |