C12H8N4O3 — CID 107706890
5-(3-pyrimidin-4-yl-1,2,4-oxadiazol-5-yl)benzene-1,3-diol (PubChem CID 107706890) has the molecular formula C12H8N4O3 and a molecular weight of 256.22 g/mol. Its IUPAC name is 5-(3-pyrimidin-4-yl-1,2,4-oxadiazol-5-yl)benzene-1,3-diol.
| Compound Name | 5-(3-pyrimidin-4-yl-1,2,4-oxadiazol-5-yl)benzene-1,3-diol |
|---|---|
| PubChem CID | 107706890 |
| Molecular Formula | C12H8N4O3 |
| Molecular Weight | 256.22 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 5-(3-pyrimidin-4-yl-1,2,4-oxadiazol-5-yl)benzene-1,3-diol |
| SMILES | Oc1cc(O)cc(-c2nc(-c3ccncn3)no2)c1 |
| InChI | InChI=1S/C12H8N4O3/c17-8-3-7(4-9(18)5-8)12-15-11(16-19-12)10-1-2-13-6-14-10/h1-6,17-18H |
| InChIKey | GMQHBKKNRKTCFT-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 105.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.22 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |