C12H9N5O2 — CID 137012853
2-amino-5-(3-pyrimidin-4-yl-1,2,4-oxadiazol-5-yl)phenol (PubChem CID 137012853) has the molecular formula C12H9N5O2 and a molecular weight of 255.24 g/mol. Its IUPAC name is 2-amino-5-(3-pyrimidin-4-yl-1,2,4-oxadiazol-5-yl)phenol.
| Compound Name | 2-amino-5-(3-pyrimidin-4-yl-1,2,4-oxadiazol-5-yl)phenol |
|---|---|
| PubChem CID | 137012853 |
| Molecular Formula | C12H9N5O2 |
| Molecular Weight | 255.24 g/mol |
| Exact Mass | 255.08 |
| IUPAC Name | 2-amino-5-(3-pyrimidin-4-yl-1,2,4-oxadiazol-5-yl)phenol |
| SMILES | Nc1ccc(-c2nc(-c3ccncn3)no2)cc1O |
| InChI | InChI=1S/C12H9N5O2/c13-8-2-1-7(5-10(8)18)12-16-11(17-19-12)9-3-4-14-6-15-9/h1-6,18H,13H2 |
| InChIKey | ZBOPEHQVFDEGEO-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 110.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.24 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|