C12H8FN5O — CID 115528928
2-fluoro-6-(3-pyrimidin-4-yl-1,2,4-oxadiazol-5-yl)aniline (PubChem CID 115528928) has the molecular formula C12H8FN5O and a molecular weight of 257.23 g/mol. Its IUPAC name is 2-fluoro-6-(3-pyrimidin-4-yl-1,2,4-oxadiazol-5-yl)aniline.
| Compound Name | 2-fluoro-6-(3-pyrimidin-4-yl-1,2,4-oxadiazol-5-yl)aniline |
|---|---|
| PubChem CID | 115528928 |
| Molecular Formula | C12H8FN5O |
| Molecular Weight | 257.23 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 2-fluoro-6-(3-pyrimidin-4-yl-1,2,4-oxadiazol-5-yl)aniline |
| SMILES | Nc1c(F)cccc1-c1nc(-c2ccncn2)no1 |
| InChI | InChI=1S/C12H8FN5O/c13-8-3-1-2-7(10(8)14)12-17-11(18-19-12)9-4-5-15-6-16-9/h1-6H,14H2 |
| InChIKey | NPBRECVFOZODDG-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 90.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.23 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|