C10H11N3O2S — CID 107707158
5-[5-(1-aminoethyl)-1,3,4-thiadiazol-2-yl]benzene-1,3-diol (PubChem CID 107707158) has the molecular formula C10H11N3O2S and a molecular weight of 237.28 g/mol. Its IUPAC name is 5-[5-(1-aminoethyl)-1,3,4-thiadiazol-2-yl]benzene-1,3-diol.
| Compound Name | 5-[5-(1-aminoethyl)-1,3,4-thiadiazol-2-yl]benzene-1,3-diol |
|---|---|
| PubChem CID | 107707158 |
| Molecular Formula | C10H11N3O2S |
| Molecular Weight | 237.28 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | 5-[5-(1-aminoethyl)-1,3,4-thiadiazol-2-yl]benzene-1,3-diol |
| SMILES | CC(N)c1nnc(-c2cc(O)cc(O)c2)s1 |
| InChI | InChI=1S/C10H11N3O2S/c1-5(11)9-12-13-10(16-9)6-2-7(14)4-8(15)3-6/h2-5,14-15H,11H2,1H3 |
| InChIKey | NRESJHXKQMKDIE-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.28 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |