C10H9Br2N3S — CID 114376146
1-[5-(2,5-dibromophenyl)-1,3,4-thiadiazol-2-yl]ethanamine (PubChem CID 114376146) has the molecular formula C10H9Br2N3S and a molecular weight of 363.08 g/mol. Its IUPAC name is 1-[5-(2,5-dibromophenyl)-1,3,4-thiadiazol-2-yl]ethanamine.
| Compound Name | 1-[5-(2,5-dibromophenyl)-1,3,4-thiadiazol-2-yl]ethanamine |
|---|---|
| PubChem CID | 114376146 |
| Molecular Formula | C10H9Br2N3S |
| Molecular Weight | 363.08 g/mol |
| Exact Mass | 360.89 |
| IUPAC Name | 1-[5-(2,5-dibromophenyl)-1,3,4-thiadiazol-2-yl]ethanamine |
| SMILES | CC(N)c1nnc(-c2cc(Br)ccc2Br)s1 |
| InChI | InChI=1S/C10H9Br2N3S/c1-5(13)9-14-15-10(16-9)7-4-6(11)2-3-8(7)12/h2-5H,13H2,1H3 |
| InChIKey | CQUANBOCLSSPNQ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.08 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |