C18H29NO2 — CID 107708134
5-[1-(4-tert-butylazepan-1-yl)ethyl]benzene-1,3-diol (PubChem CID 107708134) has the molecular formula C18H29NO2 and a molecular weight of 291.44 g/mol. Its IUPAC name is 5-[1-(4-tert-butylazepan-1-yl)ethyl]benzene-1,3-diol.
| Compound Name | 5-[1-(4-tert-butylazepan-1-yl)ethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 107708134 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | 5-[1-(4-tert-butylazepan-1-yl)ethyl]benzene-1,3-diol |
| SMILES | CC(c1cc(O)cc(O)c1)N1CCCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C18H29NO2/c1-13(14-10-16(20)12-17(21)11-14)19-8-5-6-15(7-9-19)18(2,3)4/h10-13,15,20-21H,5-9H2,1-4H3 |
| InChIKey | VYHWRSUTKUTBIC-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |