C13H20N2O3 — CID 107710571
2-[1-(2,6-dihydroxyphenyl)ethylamino]-N-propan-2-ylacetamide (PubChem CID 107710571) has the molecular formula C13H20N2O3 and a molecular weight of 252.31 g/mol. Its IUPAC name is 2-[1-(2,6-dihydroxyphenyl)ethylamino]-N-propan-2-ylacetamide.
| Compound Name | 2-[1-(2,6-dihydroxyphenyl)ethylamino]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 107710571 |
| Molecular Formula | C13H20N2O3 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 2-[1-(2,6-dihydroxyphenyl)ethylamino]-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)CNC(C)c1c(O)cccc1O |
| InChI | InChI=1S/C13H20N2O3/c1-8(2)15-12(18)7-14-9(3)13-10(16)5-4-6-11(13)17/h4-6,8-9,14,16-17H,7H2,1-3H3,(H,15,18) |
| InChIKey | KQTZAKUOBDTBLO-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|