C15H22ClN3O2 — CID 8599451
2-[[(1S)-1-(3-chlorophenyl)ethyl]amino]-N-[2-oxo-2-(propan-2-ylamino)ethyl]acetamide (PubChem CID 8599451) has the molecular formula C15H22ClN3O2 and a molecular weight of 311.81 g/mol. Its IUPAC name is 2-[[(1S)-1-(3-chlorophenyl)ethyl]amino]-N-[2-oxo-2-(propan-2-ylamino)ethyl]acetamide.
| Compound Name | 2-[[(1S)-1-(3-chlorophenyl)ethyl]amino]-N-[2-oxo-2-(propan-2-ylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 8599451 |
| Molecular Formula | C15H22ClN3O2 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | 2-[[(1S)-1-(3-chlorophenyl)ethyl]amino]-N-[2-oxo-2-(propan-2-ylamino)ethyl]acetamide |
| SMILES | CC(C)NC(=O)CNC(=O)CN[C@@H](C)c1cccc(Cl)c1 |
| InChI | InChI=1S/C15H22ClN3O2/c1-10(2)19-15(21)9-18-14(20)8-17-11(3)12-5-4-6-13(16)7-12/h4-7,10-11,17H,8-9H2,1-3H3,(H,18,20)(H,19,21)/t11-/m0/s1 |
| InChIKey | FFINPOYQXVTZBJ-NSHDSACASA-N |
| XLogP | 1.63 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |