C18H20BrClN2O — CID 9307629
N-[(1R)-1-(4-bromophenyl)ethyl]-2-[[(1S)-1-(3-chlorophenyl)ethyl]amino]acetamide (PubChem CID 9307629) has the molecular formula C18H20BrClN2O and a molecular weight of 395.73 g/mol. Its IUPAC name is N-[(1R)-1-(4-bromophenyl)ethyl]-2-[[(1S)-1-(3-chlorophenyl)ethyl]amino]acetamide.
| Compound Name | N-[(1R)-1-(4-bromophenyl)ethyl]-2-[[(1S)-1-(3-chlorophenyl)ethyl]amino]acetamide |
|---|---|
| PubChem CID | 9307629 |
| Molecular Formula | C18H20BrClN2O |
| Molecular Weight | 395.73 g/mol |
| Exact Mass | 394.04 |
| IUPAC Name | N-[(1R)-1-(4-bromophenyl)ethyl]-2-[[(1S)-1-(3-chlorophenyl)ethyl]amino]acetamide |
| SMILES | C[C@H](NCC(=O)N[C@H](C)c1ccc(Br)cc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H20BrClN2O/c1-12(15-4-3-5-17(20)10-15)21-11-18(23)22-13(2)14-6-8-16(19)9-7-14/h3-10,12-13,21H,11H2,1-2H3,(H,22,23)/t12-,13+/m0/s1 |
| InChIKey | WRAXLIRIRIVOOX-QWHCGFSZSA-N |
| XLogP | 4.63 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.73 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |