C18H20Cl2N2O — CID 9306527
N-[(1R)-1-(3-chlorophenyl)ethyl]-2-[[(1S)-1-(2-chlorophenyl)ethyl]amino]acetamide (PubChem CID 9306527) has the molecular formula C18H20Cl2N2O and a molecular weight of 351.28 g/mol. Its IUPAC name is N-[(1R)-1-(3-chlorophenyl)ethyl]-2-[[(1S)-1-(2-chlorophenyl)ethyl]amino]acetamide.
| Compound Name | N-[(1R)-1-(3-chlorophenyl)ethyl]-2-[[(1S)-1-(2-chlorophenyl)ethyl]amino]acetamide |
|---|---|
| PubChem CID | 9306527 |
| Molecular Formula | C18H20Cl2N2O |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | N-[(1R)-1-(3-chlorophenyl)ethyl]-2-[[(1S)-1-(2-chlorophenyl)ethyl]amino]acetamide |
| SMILES | C[C@H](NCC(=O)N[C@H](C)c1cccc(Cl)c1)c1ccccc1Cl |
| InChI | InChI=1S/C18H20Cl2N2O/c1-12(14-6-5-7-15(19)10-14)22-18(23)11-21-13(2)16-8-3-4-9-17(16)20/h3-10,12-13,21H,11H2,1-2H3,(H,22,23)/t12-,13+/m1/s1 |
| InChIKey | DDSIXWSXGWMEQS-OLZOCXBDSA-N |
| XLogP | 4.52 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |